Bookmark
Forward
QuickView for anthocyanins (compound)
PubChem
| Name: | Anthocyanins |
|---|---|
| PubChem Compound ID: | 145858 |
| Description: | A group of FLAVONOIDS derived from FLAVONOLS, which lack the ketone oxygen at the 4-position. They are glycosylated versions of cyanidin, pelargonidin or delphinidin. The conjugated bonds result in blue, red, and purple colors in flowers of plants. |
| Molecular formula: | C15H11O+ |
| Molecular weight: | 207.247 g/mol |
| Synonyms: |
CHEBI:36121; Anthocyanin; 11029-12-2; C15549; flavylium; InChI=1/C15H11O/c1-2-6-12(7-3-1)15-11-10-13-8-4-5-9-14(13)16-15/h1-11H/q+
|
